CAS 210964-02-6 is the registry number for tert-Butyl 4-(Chlorosulfonyl)-benzoate. Offered by: TRC. Available pack sizes: 2,5g.
Tert-butyl 4-chlorosulfonylbenzoate (CAS 210964-02-6) is a chemical compound with the molecular formula C11H13ClO4S and a molecular weight of 276.74 g/mol. IUPAC name: tert-butyl 4-chlorosulfonylbenzoate. InChIKey: QRVULNDDGCQPNM-UHFFFAOYSA-N.
| Molecular formula | C11H13ClO4S |
|---|---|
| Molecular weight | 276.74 g/mol |
| IUPAC name | tert-butyl 4-chlorosulfonylbenzoate |
| InChIKey | QRVULNDDGCQPNM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC=C(C=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)