CAS 1487188-38-4 is the registry number for 4'-Bromo-2',3'-dihydrospiro(cyclopropane-1,1'-indene), 97%. Offered by: AmBeed. Available pack sizes: 1g.
7-bromospiro[1,2-dihydroindene-3,1'-cyclopropane] (CAS 1487188-38-4) is a chemical compound with the molecular formula C11H11Br and a molecular weight of 223.11 g/mol. IUPAC name: 7-bromospiro[1,2-dihydroindene-3,1'-cyclopropane]. InChIKey: JPNASFOOOLOCGC-UHFFFAOYSA-N.
| Molecular formula | C11H11Br |
|---|---|
| Molecular weight | 223.11 g/mol |
| IUPAC name | 7-bromospiro[1,2-dihydroindene-3,1'-cyclopropane] |
| InChIKey | JPNASFOOOLOCGC-UHFFFAOYSA-N |
| SMILES | C1CC2(CC2)C3=C1C(=CC=C3)Br |
Computed by PubChem (NCBI)