CAS 2535540-02-2 is the registry number for 2-Bromo-1,3-dimethyl-5-(prop-1-yn-1-yl)benzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-1,3-dimethyl-5-prop-1-ynylbenzene (CAS 2535540-02-2) is a chemical compound with the molecular formula C11H11Br and a molecular weight of 223.11 g/mol. IUPAC name: 2-bromo-1,3-dimethyl-5-prop-1-ynylbenzene. InChIKey: LBEPAEALESYUKJ-UHFFFAOYSA-N.
| Molecular formula | C11H11Br |
|---|---|
| Molecular weight | 223.11 g/mol |
| IUPAC name | 2-bromo-1,3-dimethyl-5-prop-1-ynylbenzene |
| InChIKey | LBEPAEALESYUKJ-UHFFFAOYSA-N |
| SMILES | CC#CC1=CC(=C(C(=C1)C)Br)C |
Computed by PubChem (NCBI)