CAS 19920-77-5 is the registry number for 1-Bromo-3-cyclopentenylbenzene, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
1-bromo-3-(cyclopenten-1-yl)benzene (CAS 19920-77-5) is a chemical compound with the molecular formula C11H11Br and a molecular weight of 223.11 g/mol. IUPAC name: 1-bromo-3-(cyclopenten-1-yl)benzene. InChIKey: USXUPETZMALJMA-UHFFFAOYSA-N.
| Molecular formula | C11H11Br |
|---|---|
| Molecular weight | 223.11 g/mol |
| IUPAC name | 1-bromo-3-(cyclopenten-1-yl)benzene |
| InChIKey | USXUPETZMALJMA-UHFFFAOYSA-N |
| SMILES | C1CC=C(C1)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)