CAS 148726-71-0 appears in our catalog under these names: 2-Methoxy-6-(methylsulfonyl)aniline, 95+%, 2-Methanesulfonyl-6-methoxyaniline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-methoxy-6-methylsulfonylaniline (CAS 148726-71-0) is a chemical compound with the molecular formula C8H11NO3S and a molecular weight of 201.25 g/mol. IUPAC name: 2-methoxy-6-methylsulfonylaniline. InChIKey: MKFWDKRBZQWOIU-UHFFFAOYSA-N.
| Molecular formula | C8H11NO3S |
|---|---|
| Molecular weight | 201.25 g/mol |
| IUPAC name | 2-methoxy-6-methylsulfonylaniline |
| InChIKey | MKFWDKRBZQWOIU-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC=C1)S(=O)(=O)C)N |
Computed by PubChem (NCBI)