Products 1487680-17-0
CAS 1487680-17-0 is the registry number for 3-Cyclopropyl-5-(1H-pyrazol-1-yl)-1,2,4-thiadiazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-cyclopropyl-5-pyrazol-1-yl-1,2,4-thiadiazole (CAS 1487680-17-0) is a chemical compound with the molecular formula C8H8N4S and a molecular weight of 192.24 g/mol. IUPAC name: 3-cyclopropyl-5-pyrazol-1-yl-1,2,4-thiadiazole. InChIKey: UKJKQTXHDWVMTQ-UHFFFAOYSA-N.
| Molecular formula | C8H8N4S |
|---|---|
| Molecular weight | 192.24 g/mol |
| IUPAC name | 3-cyclopropyl-5-pyrazol-1-yl-1,2,4-thiadiazole |
| InChIKey | UKJKQTXHDWVMTQ-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NSC(=N2)N3C=CC=N3 |
Computed by PubChem (NCBI)