Products 1488589-90-7

CAS 1488589-90-7 is the registry number for Ethyl 5-(naphthalen-1-yl)-1H-1,2,4-triazole-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Ethyl 3-naphthalen-1-yl-1H-1,2,4-triazole-5-carboxylate (CAS 1488589-90-7) is a chemical compound with the molecular formula C15H13N3O2 and a molecular weight of 267.28 g/mol. IUPAC name: ethyl 3-naphthalen-1-yl-1H-1,2,4-triazole-5-carboxylate. InChIKey: ABRUIVVHAMZCEA-UHFFFAOYSA-N.

Identity
Molecular formulaC15H13N3O2
Molecular weight267.28 g/mol
IUPAC nameethyl 3-naphthalen-1-yl-1H-1,2,4-triazole-5-carboxylate
InChIKeyABRUIVVHAMZCEA-UHFFFAOYSA-N
SMILESCCOC(=O)C1=NC(=NN1)C2=CC=CC3=CC=CC=C32

Computed by PubChem (NCBI)