CAS 148868-55-7 appears in our catalog under these names: ML 10302, ML 10302, 2-(1-Piperidinyl)ethyl 4-amino-5-chloro-2-methoxybenzoate, 95%, 95%, ML 10302, 98.95%. Offered by: TRC, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 25mg, 50mg, 10mg, 5mg, 10 mg, 25 mg, 50 mg.
2-piperidin-1-ylethyl 4-amino-5-chloro-2-methoxybenzoate (CAS 148868-55-7) is a chemical compound with the molecular formula C15H21ClN2O3 and a molecular weight of 312.79 g/mol. IUPAC name: 2-piperidin-1-ylethyl 4-amino-5-chloro-2-methoxybenzoate. InChIKey: RVFIAQAAZUEPPE-UHFFFAOYSA-N.
| Molecular formula | C15H21ClN2O3 |
|---|---|
| Molecular weight | 312.79 g/mol |
| IUPAC name | 2-piperidin-1-ylethyl 4-amino-5-chloro-2-methoxybenzoate |
| InChIKey | RVFIAQAAZUEPPE-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C(=O)OCCN2CCCCC2)Cl)N |
Computed by PubChem (NCBI)