Products 2755780-14-2
CAS 2755780-14-2 is the registry number for (S)-3-((S)-2-Amino-4-(benzyloxy)-3-oxobutyl)pyrrolidin-2-one hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S)-3-[(2S)-2-amino-3-oxo-4-phenylmethoxybutyl]pyrrolidin-2-one;hydrochloride (CAS 2755780-14-2) is a chemical compound with the molecular formula C15H21ClN2O3 and a molecular weight of 312.79 g/mol. IUPAC name: (3S)-3-[(2S)-2-amino-3-oxo-4-phenylmethoxybutyl]pyrrolidin-2-one;hydrochloride. InChIKey: LCXITRODWLICJM-QNTKWALQSA-N.
| Molecular formula | C15H21ClN2O3 |
|---|---|
| Molecular weight | 312.79 g/mol |
| IUPAC name | (3S)-3-[(2S)-2-amino-3-oxo-4-phenylmethoxybutyl]pyrrolidin-2-one;hydrochloride |
| InChIKey | LCXITRODWLICJM-QNTKWALQSA-N |
| SMILES | C1CNC(=O)[C@@H]1C[C@@H](C(=O)COCC2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)