CAS 148979-72-0 is the registry number for (4R,5R)-4,5,6-Trihydroxyhexan-3-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(4R,5R)-4,5,6-trihydroxyhexan-3-one (CAS 148979-72-0) is a chemical compound with the molecular formula C6H12O4 and a molecular weight of 148.16 g/mol. IUPAC name: (4R,5R)-4,5,6-trihydroxyhexan-3-one. InChIKey: KDDGOKLLKWTTGK-RITPCOANSA-N.
| Molecular formula | C6H12O4 |
|---|---|
| Molecular weight | 148.16 g/mol |
| IUPAC name | (4R,5R)-4,5,6-trihydroxyhexan-3-one |
| InChIKey | KDDGOKLLKWTTGK-RITPCOANSA-N |
| SMILES | CCC(=O)[C@@H]([C@@H](CO)O)O |
Computed by PubChem (NCBI)