Products 148981-17-3

CAS 148981-17-3 is the registry number for 13-Oxo-9(Z),11(E),15(Z)-octadecatrienoic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

13-oxooctadeca-9,11,15-trienoic acid (CAS 148981-17-3) is a chemical compound with the molecular formula C18H28O3 and a molecular weight of 292.4 g/mol. IUPAC name: 13-oxooctadeca-9,11,15-trienoic acid. InChIKey: BNMYUQILBYIYOG-UHFFFAOYSA-N.

Identity
Molecular formulaC18H28O3
Molecular weight292.4 g/mol
IUPAC name13-oxooctadeca-9,11,15-trienoic acid
InChIKeyBNMYUQILBYIYOG-UHFFFAOYSA-N
SMILESCCC=CCC(=O)C=CC=CCCCCCCCC(=O)O

Computed by PubChem (NCBI)