CAS 1489854-56-9 appears in our catalog under these names: 5-Chloro-6-((3-chlorophenyl)methoxy)pyridine-3-carboxylic acid, 95%, 5-Chloro-6-((3-chlorophenyl)methoxy)pyridine-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
5-chloro-6-[(3-chlorophenyl)methoxy]pyridine-3-carboxylic acid (CAS 1489854-56-9) is a chemical compound with the molecular formula C13H9Cl2NO3 and a molecular weight of 298.12 g/mol. IUPAC name: 5-chloro-6-[(3-chlorophenyl)methoxy]pyridine-3-carboxylic acid. InChIKey: UXTQHTQIQSFSAF-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl2NO3 |
|---|---|
| Molecular weight | 298.12 g/mol |
| IUPAC name | 5-chloro-6-[(3-chlorophenyl)methoxy]pyridine-3-carboxylic acid |
| InChIKey | UXTQHTQIQSFSAF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)COC2=C(C=C(C=N2)C(=O)O)Cl |
Computed by PubChem (NCBI)