Products 453557-85-2
CAS 453557-85-2 is the registry number for Methyl 4-(2,4-Dichlorobenzoyl)-1H-pyrrole-2-carboxylate. Offered by: TRC. Available pack sizes: 1g, 250mg, 500mg.
Methyl 4-(2,4-dichlorobenzoyl)-1H-pyrrole-2-carboxylate (CAS 453557-85-2) is a chemical compound with the molecular formula C13H9Cl2NO3 and a molecular weight of 298.12 g/mol. IUPAC name: methyl 4-(2,4-dichlorobenzoyl)-1H-pyrrole-2-carboxylate. InChIKey: UEYWAADYIKXWJI-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl2NO3 |
|---|---|
| Molecular weight | 298.12 g/mol |
| IUPAC name | methyl 4-(2,4-dichlorobenzoyl)-1H-pyrrole-2-carboxylate |
| InChIKey | UEYWAADYIKXWJI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CN1)C(=O)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)