CAS 242797-28-0 is the registry number for 1-(2,4-Dichlorobenzyl)-6-oxo-1,6-dihydro-3-pyridinecarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-[(2,4-dichlorophenyl)methyl]-6-oxopyridine-3-carboxylic acid (CAS 242797-28-0) is a chemical compound with the molecular formula C13H9Cl2NO3 and a molecular weight of 298.12 g/mol. IUPAC name: 1-[(2,4-dichlorophenyl)methyl]-6-oxopyridine-3-carboxylic acid. InChIKey: RJEUIRLWFNXWGO-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl2NO3 |
|---|---|
| Molecular weight | 298.12 g/mol |
| IUPAC name | 1-[(2,4-dichlorophenyl)methyl]-6-oxopyridine-3-carboxylic acid |
| InChIKey | RJEUIRLWFNXWGO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)CN2C=C(C=CC2=O)C(=O)O |
Computed by PubChem (NCBI)