Products 149028-28-4
CAS 149028-28-4 is the registry number for CI-1002. Offered by: MedChemExpress. Available pack sizes: Get quote.
1,3-dichloro-6,7,8,9,10,12-hexahydroazepino[2,1-b]quinazoline (CAS 149028-28-4) is a chemical compound with the molecular formula C13H14Cl2N2 and a molecular weight of 269.17 g/mol. IUPAC name: 1,3-dichloro-6,7,8,9,10,12-hexahydroazepino[2,1-b]quinazoline. InChIKey: WTPSHLVHJOJDIF-UHFFFAOYSA-N.
| Molecular formula | C13H14Cl2N2 |
|---|---|
| Molecular weight | 269.17 g/mol |
| IUPAC name | 1,3-dichloro-6,7,8,9,10,12-hexahydroazepino[2,1-b]quinazoline |
| InChIKey | WTPSHLVHJOJDIF-UHFFFAOYSA-N |
| SMILES | C1CCC2=NC3=C(CN2CC1)C(=CC(=C3)Cl)Cl |
Computed by PubChem (NCBI)