CAS 14906-37-7 appears in our catalog under these names: Ethyl isonicotinate n-oxide, 95%, Ethyl isonicotinate 1-oxide, 95-<97%, Ethyl isonicotinate 1-oxide, 95%, 95%, ETHYL ISONICOTINATE 1-OXIDE, 95%. Offered by: Combi-blocks, Hoffman Fine Chemicals, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg.
Ethyl 1-oxidopyridin-1-ium-4-carboxylate (CAS 14906-37-7) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: ethyl 1-oxidopyridin-1-ium-4-carboxylate. InChIKey: DPWRGNWJVVSVIE-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | ethyl 1-oxidopyridin-1-ium-4-carboxylate |
| InChIKey | DPWRGNWJVVSVIE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=[N+](C=C1)[O-] |
Computed by PubChem (NCBI)