CAS 14906-63-9 appears in our catalog under these names: 3-(Ethoxycarbonyl)pyridin-1-ium-1-olate, 95%, Nicorandil Impurity 41, 3-(Ethoxycarbonyl)pyridine 1-oxide, 97%, 3-(Ethoxycarbonyl)pyridin-1-ium-1-olate. Offered by: Combi-blocks, Chemat Brand, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, on request, 0,5g.
Ethyl 1-oxidopyridin-1-ium-3-carboxylate (CAS 14906-63-9) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: ethyl 1-oxidopyridin-1-ium-3-carboxylate. InChIKey: HPFQJBOXPBNOJK-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | ethyl 1-oxidopyridin-1-ium-3-carboxylate |
| InChIKey | HPFQJBOXPBNOJK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C[N+](=CC=C1)[O-] |
Computed by PubChem (NCBI)