Products 149065-75-8
CAS 149065-75-8 appears in our catalog under these names: (S)–4–Benzyl–2–(thiophen–2–yl)–4，5–dihydrooxazole, (S)-4-Benzyl-2-(thiophen-2-yl)-4,5-dihydrooxazole, 97%, 97%, (S)-4-Benzyl-2-(thiophen-2-yl)-4,5-dihydrooxazole, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(4S)-4-benzyl-2-thiophen-2-yl-4,5-dihydro-1,3-oxazole (CAS 149065-75-8) is a chemical compound with the molecular formula C14H13NOS and a molecular weight of 243.33 g/mol. IUPAC name: (4S)-4-benzyl-2-thiophen-2-yl-4,5-dihydro-1,3-oxazole. InChIKey: QKICIDWWVZZURL-LBPRGKRZSA-N.
| Molecular formula | C14H13NOS |
|---|---|
| Molecular weight | 243.33 g/mol |
| IUPAC name | (4S)-4-benzyl-2-thiophen-2-yl-4,5-dihydro-1,3-oxazole |
| InChIKey | QKICIDWWVZZURL-LBPRGKRZSA-N |
| SMILES | C1[C@@H](N=C(O1)C2=CC=CS2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)