CAS 149080-24-0 appears in our catalog under these names: 3-(2-Bromophenyl)-2,2-dimethylpropanoic acid, 98%, 3-(2-Bromophenyl)-2,2-dimethylpropanoic acid, 3-(2-Bromophenyl)-2,2-dimethylpropanoic acid, 98%, 98%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 50mg, 0,5g, 100mg, 250mg, 500mg.
3-(2-bromophenyl)-2,2-dimethylpropanoic acid (CAS 149080-24-0) is a chemical compound with the molecular formula C11H13BrO2 and a molecular weight of 257.12 g/mol. IUPAC name: 3-(2-bromophenyl)-2,2-dimethylpropanoic acid. InChIKey: PXLOONGLASJSGK-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO2 |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | 3-(2-bromophenyl)-2,2-dimethylpropanoic acid |
| InChIKey | PXLOONGLASJSGK-UHFFFAOYSA-N |
| SMILES | CC(C)(CC1=CC=CC=C1Br)C(=O)O |
Computed by PubChem (NCBI)