Products 1491290-19-7

CAS 1491290-19-7 is the registry number for 4-(4-Bromophenyl)-1,2,3-thiadiazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

4-(4-bromophenyl)thiadiazole-5-carboxylic acid (CAS 1491290-19-7) is a chemical compound with the molecular formula C9H5BrN2O2S and a molecular weight of 285.12 g/mol. IUPAC name: 4-(4-bromophenyl)thiadiazole-5-carboxylic acid. InChIKey: KQNJSVBCNVGNJX-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5BrN2O2S
Molecular weight285.12 g/mol
IUPAC name4-(4-bromophenyl)thiadiazole-5-carboxylic acid
InChIKeyKQNJSVBCNVGNJX-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=C(SN=N2)C(=O)O)Br

Computed by PubChem (NCBI)