CAS 1491290-19-7 is the registry number for 4-(4-Bromophenyl)-1,2,3-thiadiazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-(4-bromophenyl)thiadiazole-5-carboxylic acid (CAS 1491290-19-7) is a chemical compound with the molecular formula C9H5BrN2O2S and a molecular weight of 285.12 g/mol. IUPAC name: 4-(4-bromophenyl)thiadiazole-5-carboxylic acid. InChIKey: KQNJSVBCNVGNJX-UHFFFAOYSA-N.
| Molecular formula | C9H5BrN2O2S |
|---|---|
| Molecular weight | 285.12 g/mol |
| IUPAC name | 4-(4-bromophenyl)thiadiazole-5-carboxylic acid |
| InChIKey | KQNJSVBCNVGNJX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(SN=N2)C(=O)O)Br |
Computed by PubChem (NCBI)