CAS 2242396-70-7 is the registry number for 5-Bromo-2-(4-nitrophenyl)thiazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-2-(4-nitrophenyl)-1,3-thiazole (CAS 2242396-70-7) is a chemical compound with the molecular formula C9H5BrN2O2S and a molecular weight of 285.12 g/mol. IUPAC name: 5-bromo-2-(4-nitrophenyl)-1,3-thiazole. InChIKey: VRFHDKJBJQHKQV-UHFFFAOYSA-N.
| Molecular formula | C9H5BrN2O2S |
|---|---|
| Molecular weight | 285.12 g/mol |
| IUPAC name | 5-bromo-2-(4-nitrophenyl)-1,3-thiazole |
| InChIKey | VRFHDKJBJQHKQV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC=C(S2)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)