Products 2169574-15-4

CAS 2169574-15-4 is the registry number for 2-(2-Bromopyridin-4-yl)thiazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(2-bromo-4-pyridinyl)-1,3-thiazole-4-carboxylic acid (CAS 2169574-15-4) is a chemical compound with the molecular formula C9H5BrN2O2S and a molecular weight of 285.12 g/mol. IUPAC name: 2-(2-bromo-4-pyridinyl)-1,3-thiazole-4-carboxylic acid. InChIKey: YGHLZYJEOPPKKQ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5BrN2O2S
Molecular weight285.12 g/mol
IUPAC name2-(2-bromo-4-pyridinyl)-1,3-thiazole-4-carboxylic acid
InChIKeyYGHLZYJEOPPKKQ-UHFFFAOYSA-N
SMILESC1=CN=C(C=C1C2=NC(=CS2)C(=O)O)Br

Computed by PubChem (NCBI)