CAS 149143-57-7 appears in our catalog under these names: 2-(4-Hydroxy-phenyl)-benzothiazole-6-carboxylic acid, 2-(4-Hydroxyphenyl)benzo[d]thiazole-6-carboxylic acid, 97%, 97%, 2-(4-Hydroxyphenyl)benzo[d]thiazole-6-carboxylic acid, 97%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 2g, 250mg, 5g.
2-(4-hydroxyphenyl)-1,3-benzothiazole-6-carboxylic acid (CAS 149143-57-7) is a chemical compound with the molecular formula C14H9NO3S and a molecular weight of 271.29 g/mol. IUPAC name: 2-(4-hydroxyphenyl)-1,3-benzothiazole-6-carboxylic acid. InChIKey: YCMUXDJTCIQKIJ-UHFFFAOYSA-N.
| Molecular formula | C14H9NO3S |
|---|---|
| Molecular weight | 271.29 g/mol |
| IUPAC name | 2-(4-hydroxyphenyl)-1,3-benzothiazole-6-carboxylic acid |
| InChIKey | YCMUXDJTCIQKIJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC3=C(S2)C=C(C=C3)C(=O)O)O |
Computed by PubChem (NCBI)