CAS 950114-59-7 is the registry number for 2-(2-Furyl)-4-phenyl-1,3-thiazole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-(furan-2-yl)-4-phenyl-1,3-thiazole-5-carboxylic acid (CAS 950114-59-7) is a chemical compound with the molecular formula C14H9NO3S and a molecular weight of 271.29 g/mol. IUPAC name: 2-(furan-2-yl)-4-phenyl-1,3-thiazole-5-carboxylic acid. InChIKey: ISOKSHFZZCNJOR-UHFFFAOYSA-N.
| Molecular formula | C14H9NO3S |
|---|---|
| Molecular weight | 271.29 g/mol |
| IUPAC name | 2-(furan-2-yl)-4-phenyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | ISOKSHFZZCNJOR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(SC(=N2)C3=CC=CO3)C(=O)O |
Computed by PubChem (NCBI)