CAS 78471-84-8 is the registry number for 4-(3-Oxobenzo[d]isothiazol-2(3H)-yl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(3-oxo-1,2-benzothiazol-2-yl)benzoic acid (CAS 78471-84-8) is a chemical compound with the molecular formula C14H9NO3S and a molecular weight of 271.29 g/mol. IUPAC name: 4-(3-oxo-1,2-benzothiazol-2-yl)benzoic acid. InChIKey: HXZYYVZWDFYNFZ-UHFFFAOYSA-N.
| Molecular formula | C14H9NO3S |
|---|---|
| Molecular weight | 271.29 g/mol |
| IUPAC name | 4-(3-oxo-1,2-benzothiazol-2-yl)benzoic acid |
| InChIKey | HXZYYVZWDFYNFZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(S2)C3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)