CAS 14916-63-3 appears in our catalog under these names: 6-Nitropyridin-2-amine 98%, 2-Amino-6-Nitropyridine, 98%, 98%, 2-Amino-6-nitro-pyridine, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 500mg.
6-nitropyridin-2-amine (CAS 14916-63-3) is a chemical compound with the molecular formula C5H5N3O2 and a molecular weight of 139.11 g/mol. IUPAC name: 6-nitropyridin-2-amine. InChIKey: JMAGBGSWLILKOC-UHFFFAOYSA-N.
| Molecular formula | C5H5N3O2 |
|---|---|
| Molecular weight | 139.11 g/mol |
| IUPAC name | 6-nitropyridin-2-amine |
| InChIKey | JMAGBGSWLILKOC-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)