Products 1491962-86-7

CAS 1491962-86-7 is the registry number for 1H,3H-Thieno[3,4-c]furan-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1,3-dihydrothieno[3,4-c]furan-4-carboxylic acid (CAS 1491962-86-7) is a chemical compound with the molecular formula C7H6O3S and a molecular weight of 170.19 g/mol. IUPAC name: 1,3-dihydrothieno[3,4-c]furan-4-carboxylic acid. InChIKey: GNDWYMBKLMMNKZ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6O3S
Molecular weight170.19 g/mol
IUPAC name1,3-dihydrothieno[3,4-c]furan-4-carboxylic acid
InChIKeyGNDWYMBKLMMNKZ-UHFFFAOYSA-N
SMILESC1C2=CSC(=C2CO1)C(=O)O

Computed by PubChem (NCBI)