Products 509083-56-1

CAS 509083-56-1 is the registry number for 2-Formyl-5-methylthiophene-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-formyl-5-methylthiophene-3-carboxylic acid (CAS 509083-56-1) is a chemical compound with the molecular formula C7H6O3S and a molecular weight of 170.19 g/mol. IUPAC name: 2-formyl-5-methylthiophene-3-carboxylic acid. InChIKey: VXFBPEBEMXQMQV-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6O3S
Molecular weight170.19 g/mol
IUPAC name2-formyl-5-methylthiophene-3-carboxylic acid
InChIKeyVXFBPEBEMXQMQV-UHFFFAOYSA-N
SMILESCC1=CC(=C(S1)C=O)C(=O)O

Computed by PubChem (NCBI)