Products 2167543-72-6

CAS 2167543-72-6 is the registry number for 2-Formyl-4-methylthiophene-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-formyl-4-methylthiophene-3-carboxylic acid (CAS 2167543-72-6) is a chemical compound with the molecular formula C7H6O3S and a molecular weight of 170.19 g/mol. IUPAC name: 2-formyl-4-methylthiophene-3-carboxylic acid. InChIKey: HVMKYVUIRLQEHX-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6O3S
Molecular weight170.19 g/mol
IUPAC name2-formyl-4-methylthiophene-3-carboxylic acid
InChIKeyHVMKYVUIRLQEHX-UHFFFAOYSA-N
SMILESCC1=CSC(=C1C(=O)O)C=O

Computed by PubChem (NCBI)