CAS 1493244-95-3 is the registry number for 5-Chloro-2-(4-fluorobenzoyl)aniline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2-amino-4-chlorophenyl)-(4-fluorophenyl)methanone (CAS 1493244-95-3) is a chemical compound with the molecular formula C13H9ClFNO and a molecular weight of 249.67 g/mol. IUPAC name: (2-amino-4-chlorophenyl)-(4-fluorophenyl)methanone. InChIKey: ODMBUEHQKWFMSS-UHFFFAOYSA-N.
| Molecular formula | C13H9ClFNO |
|---|---|
| Molecular weight | 249.67 g/mol |
| IUPAC name | (2-amino-4-chlorophenyl)-(4-fluorophenyl)methanone |
| InChIKey | ODMBUEHQKWFMSS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=C(C=C(C=C2)Cl)N)F |
Computed by PubChem (NCBI)