CAS 203303-05-3 appears in our catalog under these names: (2-Amino-4-chlorophenyl)(2-fluorophenyl)methanone 97%, 2-Amino-4-chloro-2'-fluorobenzophenone, 98%. Offered by: Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(2-amino-4-chlorophenyl)-(2-fluorophenyl)methanone (CAS 203303-05-3) is a chemical compound with the molecular formula C13H9ClFNO and a molecular weight of 249.67 g/mol. IUPAC name: (2-amino-4-chlorophenyl)-(2-fluorophenyl)methanone. InChIKey: OBXGOBSNRWWAOU-UHFFFAOYSA-N.
| Molecular formula | C13H9ClFNO |
|---|---|
| Molecular weight | 249.67 g/mol |
| IUPAC name | (2-amino-4-chlorophenyl)-(2-fluorophenyl)methanone |
| InChIKey | OBXGOBSNRWWAOU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=C(C=C(C=C2)Cl)N)F |
Computed by PubChem (NCBI)