CAS 784-38-3 appears in our catalog under these names: Diazepam Impurity 12, 2-Amino-5-chloro-2’-fluorobenzophenone, 2–Amino–5–chloro–2′–fluorobenzophenone, 2-Amino-5-chloro-2'-fluorobenzophenone, 2-Amino-5-chloro-2'-fluorobenzophenone, >98.0%(GC). Offered by: Chemat Brand, TRC, GLPBio, Biosynth, TCI. Available pack sizes: on request, 10g, 25g, 100g, 500g, 0,25kg, 0,1kg, 1g.
(2-amino-5-chlorophenyl)-(2-fluorophenyl)methanone (CAS 784-38-3) is a chemical compound with the molecular formula C13H9ClFNO and a molecular weight of 249.67 g/mol. IUPAC name: (2-amino-5-chlorophenyl)-(2-fluorophenyl)methanone. InChIKey: GTGMXPIQRQSORU-UHFFFAOYSA-N.
| Molecular formula | C13H9ClFNO |
|---|---|
| Molecular weight | 249.67 g/mol |
| IUPAC name | (2-amino-5-chlorophenyl)-(2-fluorophenyl)methanone |
| InChIKey | GTGMXPIQRQSORU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=C(C=CC(=C2)Cl)N)F |
Computed by PubChem (NCBI)