Products 149418-38-2
CAS 149418-38-2 appears in our catalog under these names: Feralolide, Feralolide, ≥98%. Offered by: MedChemExpress, Chemat. Available pack sizes: 5 mg, 1 mg, 5mg, 10mg, 20mg.
(3R)-3-[(2-acetyl-3,5-dihydroxyphenyl)methyl]-6,8-dihydroxy-3,4-dihydroisochromen-1-one (CAS 149418-38-2) is a chemical compound with the molecular formula C18H16O7 and a molecular weight of 344.3 g/mol. IUPAC name: (3R)-3-[(2-acetyl-3,5-dihydroxyphenyl)methyl]-6,8-dihydroxy-3,4-dihydroisochromen-1-one. InChIKey: YAAJRTVBAVFJQG-CYBMUJFWSA-N.
| Molecular formula | C18H16O7 |
|---|---|
| Molecular weight | 344.3 g/mol |
| IUPAC name | (3R)-3-[(2-acetyl-3,5-dihydroxyphenyl)methyl]-6,8-dihydroxy-3,4-dihydroisochromen-1-one |
| InChIKey | YAAJRTVBAVFJQG-CYBMUJFWSA-N |
| SMILES | CC(=O)C1=C(C=C(C=C1O)O)C[C@@H]2CC3=C(C(=CC(=C3)O)O)C(=O)O2 |
Computed by PubChem (NCBI)
Synonyms:
Feralolide, orb2277517