CAS 70028-59-0 appears in our catalog under these names: Rivularin, Rivularin, ≥98%, ≥98%. Offered by: GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 25mg, 10mg, 50mg, 10 mg, 1 mg, 25 mg, 5 mg.
5-hydroxy-2-(2-hydroxy-6-methoxyphenyl)-7,8-dimethoxychromen-4-one (CAS 70028-59-0) is a chemical compound with the molecular formula C18H16O7 and a molecular weight of 344.3 g/mol. IUPAC name: 5-hydroxy-2-(2-hydroxy-6-methoxyphenyl)-7,8-dimethoxychromen-4-one. InChIKey: IYMNRCWUEDWTPE-UHFFFAOYSA-N.
| Molecular formula | C18H16O7 |
|---|---|
| Molecular weight | 344.3 g/mol |
| IUPAC name | 5-hydroxy-2-(2-hydroxy-6-methoxyphenyl)-7,8-dimethoxychromen-4-one |
| InChIKey | IYMNRCWUEDWTPE-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1C2=CC(=O)C3=C(O2)C(=C(C=C3O)OC)OC)O |
Computed by PubChem (NCBI)