Products 4324-53-2

CAS 4324-53-2 is the registry number for Mikanin. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 25mg, 10mg, 50mg, 1 mg, 5 mg.

Structural formula: {0} (CAS {1})

3,5-dihydroxy-6,7-dimethoxy-2-(4-methoxyphenyl)chromen-4-one (CAS 4324-53-2) is a chemical compound with the molecular formula C18H16O7 and a molecular weight of 344.3 g/mol. IUPAC name: 3,5-dihydroxy-6,7-dimethoxy-2-(4-methoxyphenyl)chromen-4-one. InChIKey: SGCYGSKAUSOJND-UHFFFAOYSA-N.

Identity
Molecular formulaC18H16O7
Molecular weight344.3 g/mol
IUPAC name3,5-dihydroxy-6,7-dimethoxy-2-(4-methoxyphenyl)chromen-4-one
InChIKeySGCYGSKAUSOJND-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)C2=C(C(=O)C3=C(C(=C(C=C3O2)OC)OC)O)O

Computed by PubChem (NCBI)