CAS 4324-53-2 is the registry number for Mikanin. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 25mg, 10mg, 50mg, 1 mg, 5 mg.
3,5-dihydroxy-6,7-dimethoxy-2-(4-methoxyphenyl)chromen-4-one (CAS 4324-53-2) is a chemical compound with the molecular formula C18H16O7 and a molecular weight of 344.3 g/mol. IUPAC name: 3,5-dihydroxy-6,7-dimethoxy-2-(4-methoxyphenyl)chromen-4-one. InChIKey: SGCYGSKAUSOJND-UHFFFAOYSA-N.
| Molecular formula | C18H16O7 |
|---|---|
| Molecular weight | 344.3 g/mol |
| IUPAC name | 3,5-dihydroxy-6,7-dimethoxy-2-(4-methoxyphenyl)chromen-4-one |
| InChIKey | SGCYGSKAUSOJND-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(C(=O)C3=C(C(=C(C=C3O2)OC)OC)O)O |
Computed by PubChem (NCBI)