Products 1494670-02-8
CAS 1494670-02-8 is the registry number for 2-Ethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 100mg.
2-ethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1494670-02-8) is a chemical compound with the molecular formula C13H20BNO2 and a molecular weight of 233.12 g/mol. IUPAC name: 2-ethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: XYJDZEDMXUWYRC-UHFFFAOYSA-N.
| Molecular formula | C13H20BNO2 |
|---|---|
| Molecular weight | 233.12 g/mol |
| IUPAC name | 2-ethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | XYJDZEDMXUWYRC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(N=CC=C2)CC |
Computed by PubChem (NCBI)