Products 149471-08-9
CAS 149471-08-9 is the registry number for Kigelinone. Offered by: MedChemExpress. Available pack sizes: Get quote.
4a,7-dihydroxy-1,4-dimethyl-2,3-dihydrocyclopenta[b]anthracene-5,10-dione (CAS 149471-08-9) is a chemical compound with the molecular formula C19H16O4 and a molecular weight of 308.3 g/mol. IUPAC name: 4a,7-dihydroxy-1,4-dimethyl-2,3-dihydrocyclopenta[b]anthracene-5,10-dione. InChIKey: KPVZBJKXSXYQCW-UHFFFAOYSA-N.
| Molecular formula | C19H16O4 |
|---|---|
| Molecular weight | 308.3 g/mol |
| IUPAC name | 4a,7-dihydroxy-1,4-dimethyl-2,3-dihydrocyclopenta[b]anthracene-5,10-dione |
| InChIKey | KPVZBJKXSXYQCW-UHFFFAOYSA-N |
| SMILES | CC1=C2C=C3C(=O)C4=C(C=C(C=C4)O)C(=O)C3(C(=C2CC1)C)O |
Computed by PubChem (NCBI)