CAS 1494967-85-9 is the registry number for Methyl 3-(3,4-dichlorophenyl)-2-hydroxypropanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-(3,4-dichlorophenyl)-2-hydroxypropanoate (CAS 1494967-85-9) is a chemical compound with the molecular formula C10H10Cl2O3 and a molecular weight of 249.09 g/mol. IUPAC name: methyl 3-(3,4-dichlorophenyl)-2-hydroxypropanoate. InChIKey: RRHPFVVEKSRIIP-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2O3 |
|---|---|
| Molecular weight | 249.09 g/mol |
| IUPAC name | methyl 3-(3,4-dichlorophenyl)-2-hydroxypropanoate |
| InChIKey | RRHPFVVEKSRIIP-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CC1=CC(=C(C=C1)Cl)Cl)O |
Computed by PubChem (NCBI)