CAS 149517-97-5 is the registry number for 2-amino-5-bromo-3-hydroxybenzoic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g.
2-amino-5-bromo-3-hydroxybenzoic acid (CAS 149517-97-5) is a chemical compound with the molecular formula C7H6BrNO3 and a molecular weight of 232.03 g/mol. IUPAC name: 2-amino-5-bromo-3-hydroxybenzoic acid. InChIKey: DXYNOGDBMHRISU-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO3 |
|---|---|
| Molecular weight | 232.03 g/mol |
| IUPAC name | 2-amino-5-bromo-3-hydroxybenzoic acid |
| InChIKey | DXYNOGDBMHRISU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)N)O)Br |
Computed by PubChem (NCBI)