Products 149518-50-3

CAS 149518-50-3 appears in our catalog under these names: 1-Boc-2-Piperidineacetic acid 95%, 1-Boc-piperidine-2-ylacetic acid, 95%. Offered by: Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

2-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-2-yl]acetic acid (CAS 149518-50-3) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: 2-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-2-yl]acetic acid. InChIKey: CKAXJDBTNNEENW-UHFFFAOYSA-N.

Identity
Molecular formulaC12H21NO4
Molecular weight243.30 g/mol
IUPAC name2-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-2-yl]acetic acid
InChIKeyCKAXJDBTNNEENW-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCCCC1CC(=O)O

Computed by PubChem (NCBI)