CAS 1495264-05-5 is the registry number for Cyclopropyl(4-methoxy-2,3-dimethylphenyl)methanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Cyclopropyl-(4-methoxy-2,3-dimethylphenyl)methanone (CAS 1495264-05-5) is a chemical compound with the molecular formula C13H16O2 and a molecular weight of 204.26 g/mol. IUPAC name: cyclopropyl-(4-methoxy-2,3-dimethylphenyl)methanone. InChIKey: HOCFXWXPXHPQRI-UHFFFAOYSA-N.
| Molecular formula | C13H16O2 |
|---|---|
| Molecular weight | 204.26 g/mol |
| IUPAC name | cyclopropyl-(4-methoxy-2,3-dimethylphenyl)methanone |
| InChIKey | HOCFXWXPXHPQRI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1C)OC)C(=O)C2CC2 |
Computed by PubChem (NCBI)