Products 149542-66-5

CAS 149542-66-5 is the registry number for 2-(5,6-Dihydro-4H-pyrrolo[3,2,1-ij]quinolin-1-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)acetic acid (CAS 149542-66-5) is a chemical compound with the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. IUPAC name: 2-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)acetic acid. InChIKey: MINBWANYZWOBIU-UHFFFAOYSA-N.

Identity
Molecular formulaC13H13NO2
Molecular weight215.25 g/mol
IUPAC name2-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)acetic acid
InChIKeyMINBWANYZWOBIU-UHFFFAOYSA-N
SMILESC1CC2=C3C(=CC=C2)C(=CN3C1)CC(=O)O

Computed by PubChem (NCBI)