CAS 149542-66-5 is the registry number for 2-(5,6-Dihydro-4H-pyrrolo[3,2,1-ij]quinolin-1-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)acetic acid (CAS 149542-66-5) is a chemical compound with the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. IUPAC name: 2-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)acetic acid. InChIKey: MINBWANYZWOBIU-UHFFFAOYSA-N.
| Molecular formula | C13H13NO2 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | 2-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)acetic acid |
| InChIKey | MINBWANYZWOBIU-UHFFFAOYSA-N |
| SMILES | C1CC2=C3C(=CC=C2)C(=CN3C1)CC(=O)O |
Computed by PubChem (NCBI)