CAS 149550-20-9 appears in our catalog under these names: Ethyl 2-cyano-3-(3-(trifluoromethyl)-phenyl)acrylate, 95%, ethyl 2-cyano-3-(3-(trifluoromethyl)phenyl)acrylate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 25g, 10g.
Ethyl (E)-2-cyano-3-[3-(trifluoromethyl)phenyl]prop-2-enoate (CAS 149550-20-9) is a chemical compound with the molecular formula C13H10F3NO2 and a molecular weight of 269.22 g/mol. IUPAC name: ethyl (E)-2-cyano-3-[3-(trifluoromethyl)phenyl]prop-2-enoate. InChIKey: VDMBMCYYOMBQEP-UXBLZVDNSA-N.
| Molecular formula | C13H10F3NO2 |
|---|---|
| Molecular weight | 269.22 g/mol |
| IUPAC name | ethyl (E)-2-cyano-3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
| InChIKey | VDMBMCYYOMBQEP-UXBLZVDNSA-N |
| SMILES | CCOC(=O)/C(=C/C1=CC(=CC=C1)C(F)(F)F)/C#N |
Computed by PubChem (NCBI)