CAS 27429-68-1 appears in our catalog under these names: 2-(Piperidin-1-yl)-5-(trifluoromethyl)aniline hydrochloride, 2-(Piperidin-1-yl)-5-(trifluoromethyl)aniline hydrochloride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-piperidin-1-yl-5-(trifluoromethyl)aniline (CAS 27429-68-1) is a chemical compound with the molecular formula C12H15F3N2 and a molecular weight of 244.26 g/mol. IUPAC name: 2-piperidin-1-yl-5-(trifluoromethyl)aniline. InChIKey: BERRRZOJDANPHE-UHFFFAOYSA-N.
| Molecular formula | C12H15F3N2 |
|---|---|
| Molecular weight | 244.26 g/mol |
| IUPAC name | 2-piperidin-1-yl-5-(trifluoromethyl)aniline |
| InChIKey | BERRRZOJDANPHE-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=C(C=C(C=C2)C(F)(F)F)N |
Computed by PubChem (NCBI)