Products 1496463-90-1
CAS 1496463-90-1 is the registry number for 4-(N,1,3-Trimethyl-1H-pyrazole-5-carboxamido)butanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(2,5-dimethylpyrazole-3-carbonyl)-methylamino]butanoic acid (CAS 1496463-90-1) is a chemical compound with the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. IUPAC name: 4-[(2,5-dimethylpyrazole-3-carbonyl)-methylamino]butanoic acid. InChIKey: PWXPWLANBXDFLO-UHFFFAOYSA-N.
| Molecular formula | C11H17N3O3 |
|---|---|
| Molecular weight | 239.27 g/mol |
| IUPAC name | 4-[(2,5-dimethylpyrazole-3-carbonyl)-methylamino]butanoic acid |
| InChIKey | PWXPWLANBXDFLO-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1)C(=O)N(C)CCCC(=O)O)C |
Computed by PubChem (NCBI)