Products 1496519-32-4

CAS 1496519-32-4 is the registry number for 2-(2-(2,2-Dimethylpropanamido)propanamido)hexanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-[2-(2,2-dimethylpropanoylamino)propanoylamino]hexanoic acid (CAS 1496519-32-4) is a chemical compound with the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. IUPAC name: 2-[2-(2,2-dimethylpropanoylamino)propanoylamino]hexanoic acid. InChIKey: MDMLGSQUWBLTIH-UHFFFAOYSA-N.

Identity
Molecular formulaC14H26N2O4
Molecular weight286.37 g/mol
IUPAC name2-[2-(2,2-dimethylpropanoylamino)propanoylamino]hexanoic acid
InChIKeyMDMLGSQUWBLTIH-UHFFFAOYSA-N
SMILESCCCCC(C(=O)O)NC(=O)C(C)NC(=O)C(C)(C)C

Computed by PubChem (NCBI)