CAS 14969-00-7 appears in our catalog under these names: 2,4-Dimethyl-5-nitrophenol, 95%, 2,4-Dimethyl-5-nitrophenol, 98%, 98%, 2,4-DIMETHYL-5-NITROPHENOL, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
2,4-dimethyl-5-nitrophenol (CAS 14969-00-7) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 2,4-dimethyl-5-nitrophenol. InChIKey: OMVAMPJZESGWII-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 2,4-dimethyl-5-nitrophenol |
| InChIKey | OMVAMPJZESGWII-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1[N+](=O)[O-])O)C |
Computed by PubChem (NCBI)