CAS 149716-78-9 is the registry number for N-Boc-Pyrrolidin-2-(R)-ylboronic acid, 98%. Offered by: AmBeed. Available pack sizes: 100mg, 1g, 250mg, 5g.
[(2R)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]boronic acid (CAS 149716-78-9) is a chemical compound with the molecular formula C9H18BNO4 and a molecular weight of 215.06 g/mol. IUPAC name: [(2R)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]boronic acid. InChIKey: UIIUYLRUCQCTST-ZETCQYMHSA-N.
| Molecular formula | C9H18BNO4 |
|---|---|
| Molecular weight | 215.06 g/mol |
| IUPAC name | [(2R)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]boronic acid |
| InChIKey | UIIUYLRUCQCTST-ZETCQYMHSA-N |
| SMILES | B([C@@H]1CCCN1C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)