CAS 2225151-97-1 is the registry number for N–Pivaloyl–(morpholine–d7)–2–boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg.
[2,3,3,5,5,6,6-heptadeuterio-4-(2,2-dimethylpropanoyl)morpholin-2-yl]boronic acid (CAS 2225151-97-1) is a chemical compound with the molecular formula C9H18BNO4 and a molecular weight of 222.10 g/mol. IUPAC name: [2,3,3,5,5,6,6-heptadeuterio-4-(2,2-dimethylpropanoyl)morpholin-2-yl]boronic acid. InChIKey: YKCZVVWINCLJFG-AKMPISSDSA-N.
| Molecular formula | C9H18BNO4 |
|---|---|
| Molecular weight | 222.10 g/mol |
| IUPAC name | [2,3,3,5,5,6,6-heptadeuterio-4-(2,2-dimethylpropanoyl)morpholin-2-yl]boronic acid |
| InChIKey | YKCZVVWINCLJFG-AKMPISSDSA-N |
| SMILES | [2H]C1(C(OC(C(N1C(=O)C(C)(C)C)([2H])[2H])([2H])B(O)O)([2H])[2H])[2H] |
Computed by PubChem (NCBI)