CAS 2324786-36-7 is the registry number for (R,E)-(3-((tert-Butoxycarbonyl)amino)but-1-en-1-yl)boronic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(E,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]but-1-enyl]boronic acid (CAS 2324786-36-7) is a chemical compound with the molecular formula C9H18BNO4 and a molecular weight of 215.06 g/mol. IUPAC name: [(E,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]but-1-enyl]boronic acid. InChIKey: UXZXWEKZFBJNKD-WEWAHIQMSA-N.
| Molecular formula | C9H18BNO4 |
|---|---|
| Molecular weight | 215.06 g/mol |
| IUPAC name | [(E,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]but-1-enyl]boronic acid |
| InChIKey | UXZXWEKZFBJNKD-WEWAHIQMSA-N |
| SMILES | B(/C=C/[C@@H](C)NC(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)